 |
|
|
|
 |
|
|
Vicine
| Vicine
|
|
|
| IUPAC name
| 2,6-diamino-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-tetrahydropyranyl]oxy]-1H-pyrimidin-4-one
|
| Identifiers
|
| CAS number
| 152-93-2
|
| PubChem
| 91446
|
| SMILES
| NC=2NC(/N)=N\C(=O)C=2O[C@@H]1O[C@H](CO)C(O)[C@H](O)C1O
|
| Properties
|
| Molecular formula
| C10H16N4O7
|
| Molar mass
| 304.25664
|
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references
|
Vicine is a glycoside found in fava beans. Vicine is toxic, causing the disease favism, in individuals who have a hereditary loss of the the enzyme glucose-6-phosphate dehydrogenase,
|
| |
|
This article is licensed under the GNU Free Documentation License. It uses material from the Wikipedia article "Vicine". A list of authors is available in Wikipedia.
|
|
|
|
|
|
Top