 |
 |
 |
 |
 |
|
|
Vicine
| Vicine |
|
| IUPAC name |
2,6-diamino-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-2-tetrahydropyranyl]oxy]-1H-pyrimidin-4-one |
| Identifiers |
| CAS number |
152-93-2 |
| PubChem |
91446 |
| SMILES |
NC=2NC(/N)=N\C(=O)C=2O[C@@H]1O[C@H](CO)C(O)[C@H](O)C1O |
| Properties |
| Molecular formula |
C10H16N4O7 |
| Molar mass |
304.25664 |
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references |
Vicine is a glycoside found in fava beans. Vicine is toxic, causing the disease favism, in individuals who have a hereditary loss of the the enzyme glucose-6-phosphate dehydrogenase,
|
| |
|
This article is licensed under the GNU Free Documentation License. It uses material from the Wikipedia article "Vicine". A list of authors is available in Wikipedia.
|
|
|
|
|
|