 |
 |
 |
 |
 |
|
|
N-Phenethyl-4-piperidinone
| N-Phenethyl-4-piperidinone |
|
| IUPAC name |
1-(2-Phenylethyl)piperidin-4-one |
| Other names |
N-Phenethyl-4-piperidinone |
| Abbreviations |
NPP |
| Identifiers |
| CAS number |
39742-60-4 |
| SMILES |
C1CN(CCC1=O)CCC2=CC=CC=C2 |
| Properties |
| Molecular formula |
C13H17NO |
| Molar mass |
203.28 g mol-1 |
| Hazards |
| EU classification |
Flammable (F)
Harmful (Xn)
Dangerous for
the environment (N) |
| NFPA 704 |
|
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references |
N-Phenethyl-4-piperidinone (NPP) is a derivative of 4-piperidinone with the molecular formula C5H9NO. 4-Piperidone is used as an intermediate in the manufacture of chemicals and pharmaceutical drugs such as fentanyl.
Because of its use in the illicit manufacture of fentanyl, NPP was placed onto the list of controlled chemicals in the USA in 2007, and possession and sales of this compound are now heavily restricted.
|
| |
|
This article is licensed under the GNU Free Documentation License. It uses material from the Wikipedia article "N-Phenethyl-4-piperidinone". A list of authors is available in Wikipedia.
|
|
|
|
|
|