 |
|
|
|
 |
|
|
N-Acetyltalosaminuronic acid
| N-Acetyltalosaminuronic acid |
|
| IUPAC name |
(2R,3S,4S,5R,6R)-5-acetamido-3,4,6- trihydroxyoxane-2-carboxylic acid |
| Other names |
Talanac; α-L-N-Acetyltalosaminuronic acid; α-L-2-N-Acetylamino-2-desoxytaluronic acid; α-L-Talopyranuronic acid, 2-(acetylamino)-2-deoxy-, (5Z,11alpha,13E,15S)-; NAT |
| Identifiers |
| CAS number |
90319-06-5 |
| PubChem |
723899 |
| MeSH |
acid N-acetyltalosaminuronic acid |
| SMILES |
CC(=O)N[C@@H]1[C@@H]([C@@H]([C@@H](O[C@H]1O)C(=O)O)O)O |
| Properties |
| Molecular formula |
C8H13NO7 |
| Molar mass |
235.19132 g/mol |
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references |
N-Acetyltalosaminuronic acid is a uronic acid. It is a component of pseudopeptidoglycan, a structural polymer found in the cell walls in some types of Archaea.
|
| |
|
This article is licensed under the GNU Free Documentation License. It uses material from the Wikipedia article "N-Acetyltalosaminuronic_acid". A list of authors is available in Wikipedia.
|
|
|
|
|
|
Top