Ethylene glycol dinitrate
| Ethylene glycol dinitrate |
|
| IUPAC name |
Ethane-1,2-diyl dinitrate |
| Other names |
Ethylene glycol dinitrate, Glycol dinitrate, Ethylene dinitrate, Ethylene nitrate, 1,2-Bis(nitrooxy)ethane, Nitroglycol, 1,2-Ethanediol dinitrate, Dinitroglycol, EGDN |
| Identifiers |
| CAS number |
628-96-6 |
| SMILES |
O=N(=O)OCCON(=O)=O |
| InChI |
InChI=1/C2H4N2O6/c5-3(6)9-1-2-10-4(7)8/h1-2H2 |
| Properties |
| Molecular formula |
C2H4N2O6 |
| Molar mass |
152.1 g/mol |
| Appearance |
Oily, odorless, colourless to light yellow liquid |
| Density |
1.49 g/cm³ |
| Melting point |
-22.0 °C
|
| Boiling point |
Explodes at 114°C
|
| Solubility in water |
5 g/l |
| Hazards |
| Main hazards |
Error creating thumbnail: Error creating thumbnail:
|
| R-phrases |
R2, R26/27/28, R33 |
| S-phrases |
((S1/2)), S33, S35, S36/37, S45 |
Except where noted otherwise, data are given for
materials in their standard state
(at 25 °C, 100 kPa)
Infobox disclaimer and references |
Ethylene glycol dinitrate (EGDN), also known as nitroglycol, is a chemical compound a yellowish, oily explosive liquid obtained by nitrating ethylene glycol. Its formula is O2N-O-CH2-CH2-O-NO2. It is similar to nitroglycerin in both manufacture and properties, though it is more volatile and less viscous.
EGDN was used in manufacturing explosives to lower the freezing point of nitroglycerin, in order to produce dynamite for use in colder weather. Due to its volatility it did serve as a detection taggant in some plastic explosives, eg. Semtex, to allow more reliable explosive detection, until 1995 when it was replaced by Dimethyldinitrobutane .
Like other organic nitrates, ethylene glycol dinitrate is a vasodilator.
|